EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30O5 |
| Net Charge | 0 |
| Average Mass | 386.488 |
| Monoisotopic Mass | 386.20932 |
| SMILES | CC(=O)OCC=C(C)[C@@H]1C(C)=C[C@@H]2CC(=O)C[C@H](C)[C@H]2[C@@H]1/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C23H30O5/c1-14(9-10-28-17(4)24)22-15(2)11-18-13-19(25)12-16(3)23(18)20(22)7-5-6-8-21(26)27/h5-9,11,16,18,20,22-23H,10,12-13H2,1-4H3,(H,26,27)/b7-5+,8-6+,14-9?/t16-,18+,20+,22+,23+/m0/s1 |
| InChIKey | KZSJVHQUJGJLJU-NVOCLVQQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phomopsis (ncbitaxon:34399) | - | PubMed (32686414) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Carneic acid L (CHEBI:224349) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E)-5-[(1S,2S,4aR,8S,8aR)-2-(4-acetyloxybut-2-en-2-yl)-3,8-dimethyl-6-oxo-2,4a,5,7,8,8a-hexahydro-1H-naphthalen-1-yl]penta-2,4-dienoic acid |