EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H17NO2 |
| Net Charge | 0 |
| Average Mass | 243.306 |
| Monoisotopic Mass | 243.12593 |
| SMILES | C=CC(C)(C)n1cc(C(=O)OC)c2ccccc21 |
| InChI | InChI=1S/C15H17NO2/c1-5-15(2,3)16-10-12(14(17)18-4)11-8-6-7-9-13(11)16/h5-10H,1H2,2-4H3 |
| InChIKey | YVHMEMILZVDHEE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Elmerina caryae (ncbitaxon:1211726) | - | DOI (10.1016/s0031-9422(00)00127-8) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1H-indole-3-carboxylic acid, 1-(1,1-dimethyl-2-propenyl) methyl ester (CHEBI:224334) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| methyl 1-(2-methylbut-3-en-2-yl)indole-3-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 9951230 | ChemSpider |