EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16O5 |
| Net Charge | 0 |
| Average Mass | 252.266 |
| Monoisotopic Mass | 252.09977 |
| SMILES | CO[C@]1(C)Cc2c(C)c(O)c(C)c(O)c2C(=O)O1 |
| InChI | InChI=1S/C13H16O5/c1-6-8-5-13(3,17-4)18-12(16)9(8)11(15)7(2)10(6)14/h14-15H,5H2,1-4H3/t13-/m0/s1 |
| InChIKey | GNGADJKAEZLFTF-ZDUSSCGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | DOI (10.1007/bf02978830) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Stoloniferol A (CHEBI:224316) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 6,8-dihydroxy-3-methoxy-3,5,7-trimethyl-4H-isochromen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 23076342 | ChemSpider |