EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H56N6O10 |
| Net Charge | 0 |
| Average Mass | 768.909 |
| Monoisotopic Mass | 768.40579 |
| SMILES | CC(C)C[C@H](NC(=O)C(NC(=O)[C@@H](N)C(C)C)c1cc(O)cc(O)c1)C(=O)NC(Cc1ccccc1)C(=O)C(=O)N[C@H](C(=O)N[C@H](C(=O)O)C(C)C)C(C)C |
| InChI | InChI=1S/C39H56N6O10/c1-19(2)14-28(42-37(52)32(45-35(50)29(40)20(3)4)24-16-25(46)18-26(47)17-24)34(49)41-27(15-23-12-10-9-11-13-23)33(48)38(53)43-30(21(5)6)36(51)44-31(22(7)8)39(54)55/h9-13,16-22,27-32,46-47H,14-15,40H2,1-8H3,(H,41,49)(H,42,52)(H,43,53)(H,44,51)(H,45,50)(H,54,55)/t27?,28-,29-,30-,31-,32?/m0/s1 |
| InChIKey | VRJLRNCZYOXNGS-BHBQUVKGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (8040053) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| RPI-856 C/D (CHEBI:224282) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-2-[[3-[[(2S)-2-[[2-[[(2S)-2-amino-3-methylbutanoyl]amino]-2-(3,5-dihydroxyphenyl)acetyl]amino]-4-methylpentanoyl]amino]-2-oxo-4-phenylbutanoyl]amino]-3-methylbutanoyl]amino]-3-methylbutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 401230 | ChemSpider |