EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H34N4O2 |
| Net Charge | 0 |
| Average Mass | 434.584 |
| Monoisotopic Mass | 434.26818 |
| SMILES | CN[C@H](C(=O)N(C)[C@@H](Cc1ccccc1)C(=O)NCCc1cnc2ccccc12)C(C)C |
| InChI | InChI=1S/C26H34N4O2/c1-18(2)24(27-3)26(32)30(4)23(16-19-10-6-5-7-11-19)25(31)28-15-14-20-17-29-22-13-9-8-12-21(20)22/h5-13,17-18,23-24,27,29H,14-16H2,1-4H3,(H,28,31)/t23-,24-/m0/s1 |
| InChIKey | JWACXIROMWTVRE-ZEQRLZLVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xenorhabdus nematophila (ncbitaxon:628) | - | PubMed (25080196) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Xenortide D (CHEBI:224278) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-N-[(2S)-1-[2-(1H-indol-3-yl)ethylamino]-1-oxo-3-phenylpropan-2-yl]-N,3-dimethyl-2-(methylamino)butanamide |
| Manual Xrefs | Databases |
|---|---|
| 58112413 | ChemSpider |