EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H41N3O8 |
| Net Charge | 0 |
| Average Mass | 547.649 |
| Monoisotopic Mass | 547.28937 |
| SMILES | CC[C@H](C)C(=O)NC(Cc1ccccc1)C(=O)O[C@@H](CC(=O)O)C1[C@H](OC(C)=O)CCN1C(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C28H41N3O8/c1-6-17(4)26(35)30-20(14-19-10-8-7-9-11-19)28(37)39-22(15-23(33)34)25-21(38-18(5)32)12-13-31(25)27(36)24(29)16(2)3/h7-11,16-17,20-22,24-25H,6,12-15,29H2,1-5H3,(H,30,35)(H,33,34)/t17-,20?,21+,22-,24-,25?/m0/s1 |
| InChIKey | GOZDOQQVOQTNBQ-MJMBSILGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (5726294) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Detoxin D1 (CHEBI:224267) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (3S)-3-[(3R)-3-acetyloxy-1-[(2S)-2-amino-3-methylbutanoyl]pyrrolidin-2-yl]-3-[2-[[(2S)-2-methylbutanoyl]amino]-3-phenylpropanoyl]oxypropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8658009 | ChemSpider |