EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12O6 |
| Net Charge | 0 |
| Average Mass | 252.222 |
| Monoisotopic Mass | 252.06339 |
| SMILES | CO[C@@]1(C)OC(=O)c2c(cc(O)c(C)c2O)C1=O |
| InChI | InChI=1S/C12H12O6/c1-5-7(13)4-6-8(9(5)14)11(16)18-12(2,17-3)10(6)15/h4,13-14H,1-3H3/t12-/m0/s1 |
| InChIKey | ZIZIRWPNVKGOSB-LBPRGKRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (25996099) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6,8-dihydroxy-3-methoxy-3,7-dimethylisochromene-1,4-dione (CHEBI:224264) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 6,8-dihydroxy-3-methoxy-3,7-dimethylisochromene-1,4-dione |
| Manual Xrefs | Databases |
|---|---|
| 35516991 | ChemSpider |