EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13NO5 |
| Net Charge | 0 |
| Average Mass | 227.216 |
| Monoisotopic Mass | 227.07937 |
| SMILES | C[C@@H](OC(=O)C1=CC=C[C@H](O)[C@H]1N)C(=O)O |
| InChI | InChI=1S/C10H13NO5/c1-5(9(13)14)16-10(15)6-3-2-4-7(12)8(6)11/h2-5,7-8,12H,11H2,1H3,(H,13,14)/t5-,7+,8+/m1/s1 |
| InChIKey | IQCWWGXPBRRYAF-DTLFHODZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (5716841) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Oryzoxymycin (CHEBI:224253) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| (2R)-2-[(5S,6S)-6-amino-5-hydroxycyclohexa-1,3-diene-1-carbonyl]oxypropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4591112 | ChemSpider |