EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H32O5S |
| Net Charge | 0 |
| Average Mass | 372.527 |
| Monoisotopic Mass | 372.19705 |
| SMILES | C[C@]1(CCOS(=O)(=O)O)CC[C@H]2C(=CC[C@@H]3[C@]2(C)CCC[C@@]3(C)O)C1 |
| InChI | InChI=1S/C19H32O5S/c1-17(11-12-24-25(21,22)23)10-7-15-14(13-17)5-6-16-18(15,2)8-4-9-19(16,3)20/h5,15-16,20H,4,6-13H2,1-3H3,(H,21,22,23)/t15-,16+,17+,18+,19+/m0/s1 |
| InChIKey | MGAAHPXIGWJLPX-UURKPOQGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria (ncbitaxon:37991) | - | PubMed (24890390) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16-O-sulfo-18-norisopimar-7-en-4alpha,16-diol (CHEBI:224216) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| 2-[(2S,4aS,4bR,8R,8aR)-8-hydroxy-2,4b,8-trimethyl-3,4,4a,5,6,7,8a,9-octahydro-1H-phenanthren-2-yl]ethyl hydrogen sulate |
| Manual Xrefs | Databases |
|---|---|
| 78442327 | ChemSpider |