EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H62N6O7 |
| Net Charge | 0 |
| Average Mass | 775.004 |
| Monoisotopic Mass | 774.46800 |
| SMILES | CCC(C)[C@@H](C(=O)N1CCC[C@H]1C(=O)O)N(C)C(=O)[C@@H]1CCCN1C(=O)[C@H](C(C)C)N(C)C(=O)[C@@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)N(C)C |
| InChI | InChI=1S/C43H62N6O7/c1-9-29(4)37(42(54)49-25-17-23-34(49)43(55)56)47(8)40(52)33-22-16-24-48(33)41(53)36(28(2)3)46(7)39(51)32(26-30-18-12-10-13-19-30)44-38(50)35(45(5)6)27-31-20-14-11-15-21-31/h10-15,18-21,28-29,32-37H,9,16-17,22-27H2,1-8H3,(H,44,50)(H,55,56)/t29?,32-,33+,34+,35+,36+,37+/m1/s1 |
| InChIKey | CZTIPXPWSQRPSH-DYPPZDDJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dapis (ncbitaxon:2302373) | - | PubMed (32352773) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Iheyamide B (CHEBI:224192) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-1-[(2S)-2-[[(2S)-1-[(2S)-2-[[(2R)-2-[[(2S)-2-(dimethylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]-methylamino]-3-methylbutanoyl]pyrrolidine-2-carbonyl]-methylamino]-3-methylpentanoyl]pyrrolidine-2-carboxylic acid |