EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H24O7 |
| Net Charge | 0 |
| Average Mass | 436.460 |
| Monoisotopic Mass | 436.15220 |
| SMILES | CCC(C)CCC(=O)O[C@@H]1c2c(cc(O)c3c2C(=O)c2cccc(O)c2-3)C(=O)[C@@]2(C)O[C@@H]12 |
| InChI | InChI=1S/C25H24O7/c1-4-11(2)8-9-16(28)31-22-18-13(23(30)25(3)24(22)32-25)10-15(27)19-17-12(21(29)20(18)19)6-5-7-14(17)26/h5-7,10-11,22,24,26-27H,4,8-9H2,1-3H3/t11?,22-,24+,25-/m1/s1 |
| InChIKey | YQMGQEJXXQCDAU-SNVRGYBNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Micromonospora (ncbitaxon:1873) | - | PubMed (26465097) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fluostatin L (CHEBI:224100) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| [(3R,4S,6S)-10,13-dihydroxy-6-methyl-7,18-dioxo-5-oxapentacyclo[9.7.0.02,8.04,6.012,17]octadeca-1,8,10,12(17),13,15-hexaen-3-yl] 4-methylhexanoate |
| Manual Xrefs | Databases |
|---|---|
| 40256697 | ChemSpider |