EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H65N5O9 |
| Net Charge | 0 |
| Average Mass | 699.931 |
| Monoisotopic Mass | 699.47823 |
| SMILES | CC(C)CCC(=O)N[C@@H](C(=O)N[C@@H](C(=O)N[C@@H](CC(C)C)[C@H](O)CC(=O)N[C@H](C)C(=O)N[C@H](CC(C)C)[C@@H](O)CC(=O)O)C(C)C)C(C)C |
| InChI | InChI=1S/C35H65N5O9/c1-18(2)12-13-28(43)39-31(21(7)8)35(49)40-32(22(9)10)34(48)38-24(14-19(3)4)26(41)16-29(44)36-23(11)33(47)37-25(15-20(5)6)27(42)17-30(45)46/h18-27,31-32,41-42H,12-17H2,1-11H3,(H,36,44)(H,37,47)(H,38,48)(H,39,43)(H,40,49)(H,45,46)/t23-,24+,25-,26-,27+,31-,32-/m1/s1 |
| InChIKey | JOKUGRFMJJOCQE-ONDCUHTLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (4567545) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pepstatin C (CHEBI:224082) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (3S,4R)-3-hydroxy-4-[[(2R)-2-[[(3R,4S)-3-hydroxy-6-methyl-4-[[(2R)-3-methyl-2-[[(2R)-3-methyl-2-(4-methylpentanoylamino)butanoyl]amino]butanoyl]amino]heptanoyl]amino]propanoyl]amino]-6-methylheptanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78443171 | ChemSpider |