EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H5NO4S |
| Net Charge | -2 |
| Average Mass | 151.143 |
| Monoisotopic Mass | 150.99503 |
| SMILES | N[C@@H](CS(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C3H7NO4S/c4-2(3(5)6)1-9(7)8/h2H,1,4H2,(H,5,6)(H,7,8)/p-2/t2-/m0/s1 |
| InChIKey | ADVPTQAUNPRNPO-REOHCLBHSA-L |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-sulfinato-L-alaninate(2−) (CHEBI:224037) is a L-α-amino acid anion (CHEBI:59814) |
| 3-sulfinato-L-alaninate(2−) (CHEBI:224037) is a alkanesulfinate (CHEBI:22319) |
| 3-sulfinato-L-alaninate(2−) (CHEBI:224037) is conjugate base of 3-sulfino-L-alanine(1−) (CHEBI:61085) |
| Incoming Relation(s) |
| 3-sulfino-L-alanine(1−) (CHEBI:61085) is conjugate acid of 3-sulfinato-L-alaninate(2−) (CHEBI:224037) |
| IUPAC Name |
|---|
| 3-sulfinato-L-alaninate |
| Synonyms | Source |
|---|---|
| 3-sulfinato-L-alaninate dianion | ChEBI |
| (2R)-2-amino-3-sulfinatopropanoate | IUPAC |