EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H39NO6 |
| Net Charge | 0 |
| Average Mass | 485.621 |
| Monoisotopic Mass | 485.27774 |
| SMILES | CC(C)=CCC/C(C)=C/CCC1(C)Oc2c(c(O)cc3c2CN(CCCCC(=O)O)C3=O)CC1O |
| InChI | InChI=1S/C28H39NO6/c1-18(2)9-7-10-19(3)11-8-13-28(4)24(31)16-21-23(30)15-20-22(26(21)35-28)17-29(27(20)34)14-6-5-12-25(32)33/h9,11,15,24,30-31H,5-8,10,12-14,16-17H2,1-4H3,(H,32,33)/b19-11+ |
| InChIKey | PREWWCBUIKRUIM-YBFXNURJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stachybotrys (ncbitaxon:74721) | - | PubMed (8968387) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Staplabin (CHEBI:224030) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| 5-[2-[(3E)-4,8-dimethylnona-3,7-dienyl]-3,5-dihydroxy-2-methyl-7-oxo-4,9-dihydro-3H-pyrano[2,3-e]isoindol-8-yl]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8132644 | ChemSpider |