EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H14N2O5S2 |
| Net Charge | 0 |
| Average Mass | 402.453 |
| Monoisotopic Mass | 402.03441 |
| SMILES | O=C1C[C@@H]2SS[C@@]34C[C@@H]1[C@@H]([C@H]2O)N3C(=O)c1cc2cc(O)ccc2n1C4=O |
| InChI | InChI=1S/C18H14N2O5S2/c21-8-1-2-10-7(3-8)4-11-16(24)20-14-9-6-18(20,17(25)19(10)11)27-26-13(15(14)23)5-12(9)22/h1-4,9,13-15,21,23H,5-6H2/t9-,13-,14-,15-,18+/m0/s1 |
| InChIKey | UKMJCOXENYPZIK-YZRKZCBTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Epicoccum (ncbitaxon:104397) | - | PubMed (31975590) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Amphiepicoccin A (CHEBI:224025) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| (1R,14S,15R,16S,19R)-7,15-dihydroxy-21,22-dithia-3,13-diazahexacyclo[14.4.2.01,13.03,11.04,9.014,19]docosa-4(9),5,7,10-tetraene-2,12,18-trione |