EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H52N2O8 |
| Net Charge | 0 |
| Average Mass | 652.829 |
| Monoisotopic Mass | 652.37237 |
| SMILES | COc1cc2c(O)c(c1)NC(=O)CC(OC)C=C/C=C\C=C/CC(OC(=O)C(C)NC(=O)C1CCCCC1)C(C)C(O)/C(C)=C\CC2 |
| InChI | InChI=1S/C37H52N2O8/c1-24-15-14-18-28-21-30(46-5)22-31(35(28)42)39-33(40)23-29(45-4)19-12-7-6-8-13-20-32(25(2)34(24)41)47-37(44)26(3)38-36(43)27-16-10-9-11-17-27/h6-8,12-13,15,19,21-22,25-27,29,32,34,41-42H,9-11,14,16-18,20,23H2,1-5H3,(H,38,43)(H,39,40)/b7-6-,13-8-,19-12?,24-15- |
| InChIKey | PEANSLAKPSVOFU-YDJRDYOUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (4044410) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 22-O-methylmycotrieninII (CHEBI:224004) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| [(8Z,10Z,16Z)-15,24-dihydroxy-5,22-dimethoxy-14,16-dimethyl-3-oxo-2-azabicyclo[18.3.1]tetracosa-1(23),6,8,10,16,20(24),21-heptaen-13-yl] 2-(cyclohexanecarbonylamino)propanoate |