EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O9 |
| Net Charge | 0 |
| Average Mass | 414.451 |
| Monoisotopic Mass | 414.18898 |
| SMILES | COc1c(CC=C(C)C)c(O)cc(C)c1C(=O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C20H30O9/c1-10(2)5-6-12-13(23)7-11(3)16(19(12)28-4)20(27)29-15(9-22)18(26)17(25)14(24)8-21/h5,7,14-15,17-18,21-26H,6,8-9H2,1-4H3/t14-,15-,17-,18-/m1/s1 |
| InChIKey | BZPSXGIOCDLKCR-JOCBIADPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aiorsellinate B (CHEBI:224002) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| [(2R,3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-yl] 4-hydroxy-2-methoxy-6-methyl-3-(3-methylbut-2-enyl)benzoate |