EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H46N2O6 |
| Net Charge | 0 |
| Average Mass | 518.695 |
| Monoisotopic Mass | 518.33559 |
| SMILES | CC[C@H](C)[C@H]1C(=O)O[C@H](CCCCC[C@@H](C)O)C[C@@H](O)[C@@H](C)C(=O)N[C@H](Cc2ccccc2)C(=O)N1C |
| InChI | InChI=1S/C29H46N2O6/c1-6-19(2)26-29(36)37-23(16-12-7-9-13-20(3)32)18-25(33)21(4)27(34)30-24(28(35)31(26)5)17-22-14-10-8-11-15-22/h8,10-11,14-15,19-21,23-26,32-33H,6-7,9,12-13,16-18H2,1-5H3,(H,30,34)/t19-,20+,21+,23+,24+,25+,26-/m0/s1 |
| InChIKey | FYFLUENRPAAKQH-PFDGYMCOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Colletotrichumspecies S8 (ncbitaxon:1552291) | - | PubMed (31181925) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Colletopeptide D (CHEBI:223996) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (3S,6R,9R,10R,12R)-6-benzyl-3-[(2S)-butan-2-yl]-10-hydroxy-12-[(6R)-6-hydroxyheptyl]-4,9-dimethyl-1-oxa-4,7-diazacyclododecane-2,5,8-trione |