EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:223995 - Xylarinorditerpene I
| Formula | C19H32O2 |
| Net Charge | 0 |
| Average Mass | 292.463 |
| Monoisotopic Mass | 292.24023 |
| SMILES | C[C@]1(CCO)CC[C@H]2C(=CC[C@@H]3[C@]2(C)CCC[C@@]3(C)O)C1 |
| InChI | InChI=1S/C19H32O2/c1-17(11-12-20)10-7-15-14(13-17)5-6-16-18(15,2)8-4-9-19(16,3)21/h5,15-16,20-21H,4,6-13H2,1-3H3/t15-,16+,17+,18+,19+/m0/s1 |
| InChIKey | HCINTOUWEBPUIJ-UURKPOQGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria (ncbitaxon:37991) | - | PubMed (31961677) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Xylarinorditerpene I (CHEBI:223995) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (1R,4aR,4bS,7S,10aR)-7-(2-hydroxyethyl)-1,4a,7-trimethyl-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthren-1-ol |