EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O3 |
| Net Charge | 0 |
| Average Mass | 306.446 |
| Monoisotopic Mass | 306.21949 |
| SMILES | C[C@]1(CCO)CCC2=C(C1)C(=O)C[C@H]1[C@](C)(O)CCC[C@]21C |
| InChI | InChI=1S/C19H30O3/c1-17(9-10-20)8-5-14-13(12-17)15(21)11-16-18(14,2)6-4-7-19(16,3)22/h16,20,22H,4-12H2,1-3H3/t16-,17-,18-,19-/m1/s1 |
| InChIKey | YIHJHNNFASVDDB-NCXUSEDFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria (ncbitaxon:37991) | - | PubMed (31961677) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Xylarinorditerpene P (CHEBI:223938) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (1R,4aS,7S,10aR)-1-hydroxy-7-(2-hydroxyethyl)-1,4a,7-trimethyl-2,3,4,5,6,8,10,10a-octahydrophenanthren-9-one |