EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19NO3 |
| Net Charge | 0 |
| Average Mass | 273.332 |
| Monoisotopic Mass | 273.13649 |
| SMILES | C=C(C(C)=O)C(=C\c1cccc(O)c1N)/C(=C/O)CC |
| InChI | InChI=1S/C16H19NO3/c1-4-12(9-18)14(10(2)11(3)19)8-13-6-5-7-15(20)16(13)17/h5-9,18,20H,2,4,17H2,1,3H3/b12-9+,14-8+ |
| InChIKey | AQCVSSBXUGYGDU-VQHXNPGESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllosticta capitalensis (ncbitaxon:121624) | - | PubMed (26241103) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Guignardene A (CHEBI:223922) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| (4Z,5E)-4-[(2-amino-3-hydroxyphenyl)methylidene]-5-(hydroxymethylidene)-3-methylideneheptan-2-one |
| Manual Xrefs | Databases |
|---|---|
| 78434924 | ChemSpider |