EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:223920 - Xylarinorditerpene L
| Formula | C19H32O3 |
| Net Charge | 0 |
| Average Mass | 308.462 |
| Monoisotopic Mass | 308.23514 |
| SMILES | C[C@@]1(CCO)CC2=CC[C@@H]3[C@](C)(CCC[C@@]3(C)O)[C@H]2[C@H](O)C1 |
| InChI | InChI=1S/C19H32O3/c1-17(9-10-20)11-13-5-6-15-18(2,16(13)14(21)12-17)7-4-8-19(15,3)22/h5,14-16,20-22H,4,6-12H2,1-3H3/t14-,15-,16-,17-,18+,19-/m1/s1 |
| InChIKey | RRBMPFQYVPVGSY-VEAXJEOVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria (ncbitaxon:37991) | - | PubMed (31961677) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Xylarinorditerpene L (CHEBI:223920) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (1R,4aR,4bS,5R,7S,10aR)-7-(2-hydroxyethyl)-1,4a,7-trimethyl-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthrene-1,5-diol |