EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H40N8O8 |
| Net Charge | 0 |
| Average Mass | 556.621 |
| Monoisotopic Mass | 556.29691 |
| SMILES | CC1NC(C(=O)N[C@@H](C)C(=O)N[C@H](C(=O)O)C(C)C)C(CCC(O)C(O)CC2CN(C(N)=O)C(N)=N2)NC1=O |
| InChI | InChI=1S/C23H40N8O8/c1-9(2)16(21(37)38)30-19(35)11(4)27-20(36)17-13(29-18(34)10(3)26-17)5-6-14(32)15(33)7-12-8-31(23(25)39)22(24)28-12/h9-17,26,32-33H,5-8H2,1-4H3,(H2,24,28)(H2,25,39)(H,27,36)(H,29,34)(H,30,35)(H,37,38)/t10?,11-,12?,13?,14?,15?,16-,17?/m0/s1 |
| InChIKey | YULBZOGRTPPGQN-BMCSNDFDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies K01-0509 (ncbitaxon:1238679) | - | PubMed (18503202) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Guadinomine C1 (CHEBI:223903) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-2-[[3-[5-(2-amino-1-carbamoyl-4,5-dihydroimidazol-4-yl)-3,4-dihydroxypentyl]-6-methyl-5-oxopiperazine-2-carbonyl]amino]propanoyl]amino]-3-methylbutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78445682 | ChemSpider |