EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C50H38O11 |
| Net Charge | 0 |
| Average Mass | 814.843 |
| Monoisotopic Mass | 814.24141 |
| SMILES | O=C1C(Cc2ccc(O)cc2)=C(Cc2ccc(O)cc2)C(=O)C1(c1ccc(O)cc1)[C@]1(c2ccc(O)cc2)C(=O)C(Cc2ccc(O)cc2)=C(Cc2ccc(O)cc2O)C1=O |
| InChI | InChI=1S/C50H38O11/c51-34-12-1-28(2-13-34)23-40-41(24-29-3-14-35(52)15-4-29)46(59)49(45(40)58,32-8-19-37(54)20-9-32)50(33-10-21-38(55)22-11-33)47(60)42(25-30-5-16-36(53)17-6-30)43(48(50)61)26-31-7-18-39(56)27-44(31)57/h1-22,27,51-57H,23-26H2/t50-/m1/s1 |
| InChIKey | RLVXRRBFCACGMY-VCZQVZGSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nostoc (ncbitaxon:1177) | - | PubMed (31977209) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nostotrebin 7 (CHEBI:223900) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| 2-[3-[(2,4-dihydroxyphenyl)methyl]-1-(4-hydroxyphenyl)-4-[(4-hydroxyphenyl)methyl]-2,5-dioxocyclopent-3-en-1-yl]-2-(4-hydroxyphenyl)-4,5-bis[(4-hydroxyphenyl)methyl]cyclopent-4-ene-1,3-dione |