EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17N3O5 |
| Net Charge | 0 |
| Average Mass | 283.284 |
| Monoisotopic Mass | 283.11682 |
| SMILES | O=C(O)CC[C@@H]1NC(=O)[C@@H]2CCCN2C(=O)CNC1=O |
| InChI | InChI=1S/C12H17N3O5/c16-9-6-13-11(19)7(3-4-10(17)18)14-12(20)8-2-1-5-15(8)9/h7-8H,1-6H2,(H,13,19)(H,14,20)(H,17,18)/t7-,8-/m0/s1 |
| InChIKey | VGNAMNNHMPYOHS-YUMQZZPRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ruegeriaspecies (ncbitaxon:1879320) | - | PubMed (15270577) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cyclo-(glycyl-L-prolyl-L-glutamyl) (CHEBI:223805) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| 3-[(3S,11aS)-1,4,7-trioxo-2,3,5,6,9,10,11,11a-octahydropyrrolo[1,2-a][1,4,7]triazonin-3-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9452548 | ChemSpider |