EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H52N4O8 |
| Net Charge | 0 |
| Average Mass | 632.799 |
| Monoisotopic Mass | 632.37851 |
| SMILES | CCCCCCCC(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(C)C)C(=O)O)C(C)C |
| InChI | InChI=1S/C33H52N4O8/c1-6-7-8-9-13-16-27(38)37-29(22(4)5)32(43)35-25(20-23-14-11-10-12-15-23)31(42)34-24(17-18-28(39)40)30(41)36-26(33(44)45)19-21(2)3/h10-12,14-15,21-22,24-26,29H,6-9,13,16-20H2,1-5H3,(H,34,42)(H,35,43)(H,36,41)(H,37,38)(H,39,40)(H,44,45)/t24-,25-,26-,29-/m0/s1 |
| InChIKey | RWFPDXLVEWLFGL-VZTVMPNDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycetohabitans rhizoxinica (ncbitaxon:412963) | - | PubMed (32031805) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Holrhizin G (CHEBI:223778) is a polypeptide (CHEBI:15841) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-4-carboxy-2-[[(2S)-2-[[(2S)-3-methyl-2-(octanoylamino)butanoyl]amino]-3-phenylpropanoyl]amino]butanoyl]amino]-4-methylpentanoic acid |