EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18O4 |
| Net Charge | 0 |
| Average Mass | 274.316 |
| Monoisotopic Mass | 274.12051 |
| SMILES | CCC/C=C/C=C/[C@@H]1Cc2cc(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C16H18O4/c1-2-3-4-5-6-7-13-9-11-8-12(17)10-14(18)15(11)16(19)20-13/h4-8,10,13,17-18H,2-3,9H2,1H3/b5-4+,7-6+/t13-/m1/s1 |
| InChIKey | NWSIBKOHHNLGBR-FCTYEHLBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillusspecies (ncbitaxon:5065) | - | PubMed (31012585) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-[(1'E,3'E)-1′,3'-heptadienyl]-6,8-dihydroxy-1',3'-dienylisocoumarin (CHEBI:223744) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 3-[(1E,3E)-hepta-1,3-dienyl]-6,8-dihydroxy-3,4-dihydroisochromen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 74832050 | ChemSpider |