EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20O3 |
| Net Charge | 0 |
| Average Mass | 284.355 |
| Monoisotopic Mass | 284.14124 |
| SMILES | C=C[C@@H]1CC2=C(O)C(=O)C3=C(CCCC3(C)C)C2=CC1=O |
| InChI | InChI=1S/C18H20O3/c1-4-10-8-13-12(9-14(10)19)11-6-5-7-18(2,3)15(11)17(21)16(13)20/h4,9-10,20H,1,5-8H2,2-3H3/t10-/m1/s1 |
| InChIKey | DNCRAHGGYRUQBA-SNVBAGLBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (30995043) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Taichunin D (CHEBI:223702) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (2S)-2-ethenyl-10-hydroxy-8,8-dimethyl-2,5,6,7-tetrahydro-1H-phenanthrene-3,9-dione |