EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15N3O3 |
| Net Charge | 0 |
| Average Mass | 249.270 |
| Monoisotopic Mass | 249.11134 |
| SMILES | CC(=O)N[C@@H](C)C(=O)Nc1ccccc1C(N)=O |
| InChI | InChI=1S/C12H15N3O3/c1-7(14-8(2)16)12(18)15-10-6-4-3-5-9(10)11(13)17/h3-7H,1-2H3,(H2,13,17)(H,14,16)(H,15,18)/t7-/m0/s1 |
| InChIKey | TVWVXIWYFXAZHZ-ZETCQYMHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicilliumspecies (ncbitaxon:5081) | - | PubMed (9630869) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NI15501A (CHEBI:223699) is a amidobenzoic acid (CHEBI:48470) |
| IUPAC Name |
|---|
| 2-[[(2S)-2-acetamidopropanoyl]amino]benzamide |
| Manual Xrefs | Databases |
|---|---|
| 8013537 | ChemSpider |