EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H5NO2 |
| Net Charge | 0 |
| Average Mass | 99.089 |
| Monoisotopic Mass | 99.03203 |
| SMILES | C#CNCC(=O)O |
| InChI | InChI=1S/C4H5NO2/c1-2-5-3-4(6)7/h1,5H,3H2,(H,6,7) |
| InChIKey | ANXDEIFQHQXTFG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces catenulae (ncbitaxon:66875) | - | PubMed (7380723) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FR-900130 (CHEBI:223616) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-(ethynylamino)acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 67038677 | ChemSpider |