EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15ClN2O5 |
| Net Charge | 0 |
| Average Mass | 278.692 |
| Monoisotopic Mass | 278.06695 |
| SMILES | CC(C)C(N)C(=O)NC(C(=O)O)/C(Cl)=C/C(=O)O |
| InChI | InChI=1S/C10H15ClN2O5/c1-4(2)7(12)9(16)13-8(10(17)18)5(11)3-6(14)15/h3-4,7-8H,12H2,1-2H3,(H,13,16)(H,14,15)(H,17,18)/b5-3- |
| InChIKey | LIRMHXHUVGJKBB-HYXAFXHYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kitasatospora xanthocidica (ncbitaxon:83382) | - | PubMed (6897940) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FR-900148 (CHEBI:223587) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (Z)-4-[(2-amino-3-methylbutanoyl)amino]-3-chloropent-2-enedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 5289550 | ChemSpider |