EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:223576 - Ganodermalactone R
| Formula | C32H46O5 |
| Net Charge | 0 |
| Average Mass | 510.715 |
| Monoisotopic Mass | 510.33452 |
| SMILES | CC(=O)OC[C@]12CCC(=O)C(C)(C)[C@@H]1CCC1=C2CC[C@]2(C)[C@@H]([C@H](C)[C@@H]3CC=C(C)C(=O)O3)CC[C@@]12C |
| InChI | InChI=1S/C32H46O5/c1-19-8-10-25(37-28(19)35)20(2)22-12-15-31(7)23-9-11-26-29(4,5)27(34)14-17-32(26,18-36-21(3)33)24(23)13-16-30(22,31)6/h8,20,22,25-26H,9-18H2,1-7H3/t20-,22+,25-,26-,30+,31-,32-/m0/s1 |
| InChIKey | JLDSFXNHQDGIKF-UANBTYQASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tomophagusspecies (ncbitaxon:2782489) | - | PubMed (30983350) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ganodermalactone R (CHEBI:223576) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| [(5R,10R,13R,14R,17R)-4,4,13,14-tetramethyl-17-[(1S)-1-[(2S)-5-methyl-6-oxo-2,3-dihydropyran-2-yl]ethyl]-3-oxo-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-10-yl]methyl acetate |