EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:223571 - Ganodermalactone Q
| Formula | C32H48O6 |
| Net Charge | 0 |
| Average Mass | 528.730 |
| Monoisotopic Mass | 528.34509 |
| SMILES | CC(=O)OC[C@]12CC[C@H](O)C(C)(C)[C@@H]1CCC1=C2CC[C@]2(C)[C@@H]([C@H](C)[C@H]3OC(=O)C(C)=C[C@@H]3O)CC[C@@]12C |
| InChI | InChI=1S/C32H48O6/c1-18-16-24(34)27(38-28(18)36)19(2)21-10-13-31(7)22-8-9-25-29(4,5)26(35)12-15-32(25,17-37-20(3)33)23(22)11-14-30(21,31)6/h16,19,21,24-27,34-35H,8-15,17H2,1-7H3/t19-,21+,24-,25-,26-,27+,30+,31-,32-/m0/s1 |
| InChIKey | OPIXTBMJGOZAFV-VPTAZODBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tomophagusspecies (ncbitaxon:2782489) | - | PubMed (30983350) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ganodermalactone Q (CHEBI:223571) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| [(3S,5R,10R,13R,14R,17R)-3-hydroxy-17-[(1S)-1-[(2R,3S)-3-hydroxy-5-methyl-6-oxo-2,3-dihydropyran-2-yl]ethyl]-4,4,13,14-tetramethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-10-yl]methyl acetate |
| Manual Xrefs | Databases |
|---|---|
| 128441428 | ChemSpider |