EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12O3 |
| Net Charge | 0 |
| Average Mass | 168.192 |
| Monoisotopic Mass | 168.07864 |
| SMILES | O=C(O)CCCCCc1cc1=O |
| InChI | InChI=1S/C9H12O3/c10-8-6-7(8)4-2-1-3-5-9(11)12/h6H,1-5H2,(H,11,12) |
| InChIKey | PILZQFAVBOKECT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycobacterium tuberculosis (ncbitaxon:1773) | - | DOI (10.1021/ja992355s) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Alutacenoic acid A (CHEBI:223570) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 6-(3-oxocyclopropen-1-yl)hexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9994065 | ChemSpider |