EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28411 - allicin
| Formula | C6H10OS2 |
| Net Charge | 0 |
| Average Mass | 162.279 |
| Monoisotopic Mass | 162.01731 |
| SMILES | C=CCSS(=O)CC=C |
| InChI | InChI=1S/C6H10OS2/c1-3-5-8-9(7)6-4-2/h3-4H,1-2,5-6H2 |
| InChIKey | JDLKFOPOAOFWQN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| allicin (CHEBI:28411) has role antibacterial agent (CHEBI:33282) |
| allicin (CHEBI:28411) is a botanical anti-fungal agent (CHEBI:86494) |
| allicin (CHEBI:28411) is a sulfoxide (CHEBI:22063) |
| IUPAC Name |
|---|
| S-allyl prop-2-ene-1-sulfinothioate |
| Synonyms | Source |
|---|---|
| 2-Propene-1-sulfinothioic acid S-2-propenyl ester | KEGG COMPOUND |
| Allicin | KEGG COMPOUND |
| thio-2-propene-1-sulfinic acid S-allyl ester | ChEBI |
| UniProt Name | Source |
|---|---|
| allicin | UniProt |