EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:28411 - allicin
| Formula | C6H10OS2 |
| Net Charge | 0 |
| Average Mass | 162.279 |
| Monoisotopic Mass | 162.01731 |
| SMILES | C=CCSS(=O)CC=C |
| InChI | InChI=1S/C6H10OS2/c1-3-5-8-9(7)6-4-2/h3-4H,1-2,5-6H2 |
| InChIKey | JDLKFOPOAOFWQN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| allicin (CHEBI:28411) has role antibacterial agent (CHEBI:33282) |
| allicin (CHEBI:28411) has role antineoplastic agent (CHEBI:35610) |
| allicin (CHEBI:28411) is a botanical anti-fungal agent (CHEBI:86494) |
| allicin (CHEBI:28411) is a sulfoxide (CHEBI:22063) |
| IUPAC Name |
|---|
| S-allyl prop-2-ene-1-sulfinothioate |
| Synonyms | Source |
|---|---|
| 2-Propene-1-sulfinothioic acid S-2-propenyl ester | KEGG COMPOUND |
| Allicin | KEGG COMPOUND |
| Diallyl thiosulfinate | ChEMBL |
| thio-2-propene-1-sulfinic acid S-allyl ester | ChEBI |
| UniProt Name | Source |
|---|---|
| allicin | UniProt |
| Citations |
|---|