EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H26Cl6N4O10S |
| Net Charge | 0 |
| Average Mass | 1015.495 |
| Monoisotopic Mass | 1011.95008 |
| SMILES | O=C(c1cc(Cl)c(Cl)n1)c1c(O)ccc(Cc2cc([C@@H](c3csc(-c4ccccc4O)n3)c3ccc(O)c(C(=O)c4cc(Cl)c(Cl)n4)c3O)c(O)c(C(=O)c3cc(Cl)c(Cl)n3)c2O)c1O |
| InChI | InChI=1S/C44H26Cl6N4O10S/c45-20-11-23(51-41(20)48)38(62)31-28(56)7-5-15(34(31)58)9-16-10-19(37(61)33(35(16)59)40(64)25-13-22(47)43(50)53-25)30(26-14-65-44(54-26)17-3-1-2-4-27(17)55)18-6-8-29(57)32(36(18)60)39(63)24-12-21(46)42(49)52-24/h1-8,10-14,30,51-53,55-61H,9H2/t30-/m0/s1 |
| InChIKey | MADIKJAZYIGDAS-PMERELPUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas (ncbitaxon:286) | - | PubMed (30793902) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mindapyrrole C (CHEBI:223467) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| [3-[[3-(4,5-dichloro-1H-pyrrole-2-carbonyl)-5-[[3-(4,5-dichloro-1H-pyrrole-2-carbonyl)-2,4-dihydroxyphenyl]-[2-(2-hydroxyphenyl)-1,3-thiazol-4-yl]methyl]-2,4-dihydroxyphenyl]methyl]-2,6-dihydroxyphenyl]-(4,5-dichloro-1H-pyrrol-2-yl)methanone |
| Manual Xrefs | Databases |
|---|---|
| 73930334 | ChemSpider |