EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H40N2O9 |
| Net Charge | 0 |
| Average Mass | 548.633 |
| Monoisotopic Mass | 548.27338 |
| SMILES | CCCC[C@H]1C(=O)O[C@H](C)[C@H](NC(=O)c2cccc(NC=O)c2O)C(=O)O[C@@H](C)[C@@H]1OC(=O)CCC(C)CC |
| InChI | InChI=1S/C28H40N2O9/c1-6-8-10-20-25(39-22(32)14-13-16(3)7-2)18(5)38-28(36)23(17(4)37-27(20)35)30-26(34)19-11-9-12-21(24(19)33)29-15-31/h9,11-12,15-18,20,23,25,33H,6-8,10,13-14H2,1-5H3,(H,29,31)(H,30,34)/t16?,17-,18+,20-,23+,25+/m1/s1 |
| InChIKey | DBRQOXPBANMULX-WJYIPEHTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (16161485) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Antimycin A13 (CHEBI:223405) is a amidobenzoic acid (CHEBI:48470) |
| IUPAC Name |
|---|
| [(2R,3S,6S,7R,8R)-8-butyl-3-[(3-ormamido-2-hydroxybenzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 4-methylhexanoate |
| Manual Xrefs | Databases |
|---|---|
| 9482332 | ChemSpider |