EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12N2O3 |
| Net Charge | 0 |
| Average Mass | 280.283 |
| Monoisotopic Mass | 280.08479 |
| SMILES | COC(=O)/C=C/C(=O)c1nccc2c1nc1ccccc12 |
| InChI | InChI=1S/C16H12N2O3/c1-21-14(20)7-6-13(19)16-15-11(8-9-17-16)10-4-2-3-5-12(10)18-15/h2-9,18H,1H3/b7-6+ |
| InChIKey | IAXJBVZHNNLOND-VOTSOKGWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (18715034) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(9H-beta-carbolin-1-yl)-4-oxobut-2-enoic acid methyl ester (CHEBI:223365) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| methyl (E)-4-oxo-4-(9H-pyrido[3,4-b]indol-1-yl)but-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 24710437 | ChemSpider |