EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16N2O5S |
| Net Charge | 0 |
| Average Mass | 324.358 |
| Monoisotopic Mass | 324.07799 |
| SMILES | CC(=O)N/C=C/SC1=C(C(=O)O)N2C(=O)/C(=C(\C)CO)[C@@H]2C1 |
| InChI | InChI=1S/C14H16N2O5S/c1-7(6-17)11-9-5-10(22-4-3-15-8(2)18)12(14(20)21)16(9)13(11)19/h3-4,9,17H,5-6H2,1-2H3,(H,15,18)(H,20,21)/b4-3+,11-7+/t9-/m0/s1 |
| InChIKey | OXRGPSLVPTUXTM-KHEUGVFDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (7068508) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asparenomycin C (CHEBI:223359) is a carbapenems (CHEBI:46633) |
| IUPAC Name |
|---|
| (5S,6E)-3-[(E)-2-acetamidoethenyl]sulanyl-6-(1-hydroxypropan-2-ylidene)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78443082 | ChemSpider |