EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20N2O4 |
| Net Charge | 0 |
| Average Mass | 340.379 |
| Monoisotopic Mass | 340.14231 |
| SMILES | C[C@@H](O)CCCCC(=O)c1nc(C(=O)O)cc2c1nc1ccccc12 |
| InChI | InChI=1S/C19H20N2O4/c1-11(22)6-2-5-9-16(23)18-17-13(10-15(21-18)19(24)25)12-7-3-4-8-14(12)20-17/h3-4,7-8,10-11,20,22H,2,5-6,9H2,1H3,(H,24,25)/t11-/m1/s1 |
| InChIKey | SPZYHUFOTARXDP-LLVKDONJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nonomuraeaspecies (ncbitaxon:1883105) | - | PubMed (32192170) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nonocarboline D (CHEBI:223351) is a harmala alkaloid (CHEBI:61379) |