EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:223300 - Acremonidin D
| Formula | C33H28O14 |
| Net Charge | 0 |
| Average Mass | 648.573 |
| Monoisotopic Mass | 648.14791 |
| SMILES | COC(=O)c1c(O)ccc(O)c1C(=O)c1c(O)cc(C)c(Cc2c(C)cc(O)c(C(=O)c3c(O)ccc(O)c3C(=O)OC)c2O)c1O |
| InChI | InChI=1S/C33H28O14/c1-12-9-20(38)26(30(42)22-16(34)5-7-18(36)24(22)32(44)46-3)28(40)14(12)11-15-13(2)10-21(39)27(29(15)41)31(43)23-17(35)6-8-19(37)25(23)33(45)47-4/h5-10,34-41H,11H2,1-4H3 |
| InChIKey | PEJXBOKZKHYSKZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acremonium (ncbitaxon:159075) | - | PubMed (14763558) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Acremonidin D (CHEBI:223300) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| methyl 2-[3-[[3-(3,6-dihydroxy-2-methoxycarbonylbenzoyl)-2,4-dihydroxy-6-methylphenyl]methyl]-2,6-dihydroxy-4-methylbenzoyl]-3,6-dihydroxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| 8434171 | ChemSpider |