EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H31ClO6 |
| Net Charge | 0 |
| Average Mass | 462.970 |
| Monoisotopic Mass | 462.18092 |
| SMILES | C=C(C)C(O)CC/C(C)=C/C[C@]1(O)C(=O)c2cc(O)cc(O)c2C(=O)[C@@]1(Cl)CC=C(C)C |
| InChI | InChI=1S/C25H31ClO6/c1-14(2)8-10-24(26)23(31)21-18(12-17(27)13-20(21)29)22(30)25(24,32)11-9-16(5)6-7-19(28)15(3)4/h8-9,12-13,19,27-29,32H,3,6-7,10-11H2,1-2,4-5H3/b16-9+/t19?,24-,25-/m0/s1 |
| InChIKey | VOBVZEIIAWUAKN-WMCYKRLGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (32051568) |
| Roles Classification |
|---|
| Biological Roles: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| delta7′′,8′′-6′′-hydroxynaphthomevalin (CHEBI:223254) is a vitamin K (CHEBI:28384) |
| IUPAC Name |
|---|
| (2S,3R)-3-chloro-2,5,7-trihydroxy-2-[(2E)-6-hydroxy-3,7-dimethylocta-2,7-dienyl]-3-(3-methylbut-2-enyl)naphthalene-1,4-dione |