EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H25NO9 |
| Net Charge | 0 |
| Average Mass | 459.451 |
| Monoisotopic Mass | 459.15293 |
| SMILES | COc1c(O)cc2c(OC)c3c(c(O)c2c1O)C(=O)CC1CC(O)(C2CN2C)CC(=O)C31O |
| InChI | InChI=1S/C23H25NO9/c1-24-8-13(24)22(30)6-9-4-11(25)16-17(23(9,31)14(27)7-22)20(32-2)10-5-12(26)21(33-3)19(29)15(10)18(16)28/h5,9,13,26,28-31H,4,6-8H2,1-3H3 |
| InChIKey | FGEKNLXFZXJGOO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Amycolatopsis (ncbitaxon:1813) | - | PubMed (7490223) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Azicemicin A (CHEBI:223231) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| 3,7,8,10,12b-pentahydroxy-9,12-dimethoxy-3-(1-methylaziridin-2-yl)-2,4,4a,5-tetrahydrobenzo[a]anthracene-1,6-dione |
| Manual Xrefs | Databases |
|---|---|
| 140951 | ChemSpider |