EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H35NO11 |
| Net Charge | 0 |
| Average Mass | 597.617 |
| Monoisotopic Mass | 597.22101 |
| SMILES | COC(=O)[C@@H]1c2cc3c(c(O)c2[C@@H](O[C@H]2C[C@H](N(C)C)[C@H](O)[C@@H](C)O2)C[C@@]1(O)CC(C)=O)C(=O)c1c(O)cccc1C3=O |
| InChI | InChI=1S/C31H35NO11/c1-13(33)11-31(40)12-20(43-21-10-18(32(3)4)26(35)14(2)42-21)23-16(25(31)30(39)41-5)9-17-24(29(23)38)28(37)22-15(27(17)36)7-6-8-19(22)34/h6-9,14,18,20-21,25-26,34-35,38,40H,10-12H2,1-5H3/t14-,18+,20+,21+,25+,26-,31+/m1/s1 |
| InChIKey | YPHXBUMJGHZUMJ-IQPZYDOFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (7186414) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sulfurmycin D (CHEBI:223186) is a anthracycline (CHEBI:48120) |
| IUPAC Name |
|---|
| methyl (1R,2R,4S)-4-[(2R,4S,5S,6R)-4-(dimethylamino)-5-hydroxy-6-methyloxan-2-yl]oxy-2,5,7-trihydroxy-6,11-dioxo-2-(2-oxopropyl)-3,4-dihydro-1H-tetracene-1-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 78443066 | ChemSpider |