EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16O6 |
| Net Charge | 0 |
| Average Mass | 256.254 |
| Monoisotopic Mass | 256.09469 |
| SMILES | CC(=O)O[C@@H]1C[C@@H](C)OC(=O)[C@H]2O[C@H]2/C=C/[C@@H]1O |
| InChI | InChI=1S/C12H16O6/c1-6-5-10(17-7(2)13)8(14)3-4-9-11(18-9)12(15)16-6/h3-4,6,8-11,14H,5H2,1-2H3/b4-3+/t6-,8+,9+,10-,11+/m1/s1 |
| InChIKey | GITGKBOJRJGOIP-GGFJVNIXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phomopsisspecies (ncbitaxon:1715245) | - | PubMed (18336005) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8alpha-acetoxymultiplolide A (CHEBI:223184) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| [(1S,4R,6R,7S,8E,10S)-7-hydroxy-4-methyl-2-oxo-3,11-dioxabicyclo[8.1.0]undec-8-en-6-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 21194954 | ChemSpider |