EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H33N5O11 |
| Net Charge | 0 |
| Average Mass | 519.508 |
| Monoisotopic Mass | 519.21766 |
| SMILES | C[C@H](NC(=O)[C@@H](C)O)C(=O)NC(CCC(=O)N[C@H](CCC[C@@H](N)C(=O)O)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H33N5O11/c1-9(23-17(31)10(2)26)16(30)25-13(20(35)36)6-7-14(27)24-12(18(32)22-8-15(28)29)5-3-4-11(21)19(33)34/h9-13,26H,3-8,21H2,1-2H3,(H,22,32)(H,23,31)(H,24,27)(H,25,30)(H,28,29)(H,33,34)(H,35,36)/t9-,10+,11+,12+,13?/m0/s1 |
| InChIKey | RNZKYQHTFUFVSS-ZLUZDFLPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (7174516) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FK-156 (CHEBI:223160) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2R,6R)-2-amino-6-[[4-carboxy-4-[[(2S)-2-[[(2R)-2-hydroxypropanoyl]amino]propanoyl]amino]butanoyl]amino]-7-(carboxymethylamino)-7-oxoheptanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 108828 | ChemSpider |