EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O6 |
| Net Charge | 0 |
| Average Mass | 300.351 |
| Monoisotopic Mass | 300.15729 |
| SMILES | C[C@@]1(O)[C@H](O)C[C@@H]2[C@](C)(CCC[C@]2(C)C(=O)O)[C@H]1C(=O)O |
| InChI | InChI=1S/C15H24O6/c1-13-5-4-6-14(2,12(19)20)8(13)7-9(16)15(3,21)10(13)11(17)18/h8-10,16,21H,4-7H2,1-3H3,(H,17,18)(H,19,20)/t8-,9-,10-,13+,14+,15-/m1/s1 |
| InChIKey | HEAXEMQGICTZSM-UDCMDWLOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arecophila (ncbitaxon:189360) | - | PubMed (23079766) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arecoic acid A (CHEBI:223147) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| (1R,2S,3R,4aR,5S,8aS)-2,3-dihydroxy-2,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalene-1,5-dicarboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78442343 | ChemSpider |