EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26N2O5 |
| Net Charge | 0 |
| Average Mass | 374.437 |
| Monoisotopic Mass | 374.18417 |
| SMILES | CC(/C=C/C(=O)NC(CO)C(=O)O)=C\[C@@H](C)C(=O)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C20H26N2O5/c1-13(5-10-18(24)21-17(12-23)20(26)27)11-14(2)19(25)15-6-8-16(9-7-15)22(3)4/h5-11,14,17,23H,12H2,1-4H3,(H,21,24)(H,26,27)/b10-5+,13-11+/t14-,17?/m1/s1 |
| InChIKey | KCRBMZBNQSKRNL-OFFUNWNUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (19300468) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[[(2E,4E,6R)-7-[4-(dimethylamino)phenyl]-4,6-dimethyl-7-oxohepta-2,4-dienoyl]amino]-3-hydroxypropanoic acid (CHEBI:223145) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-[[(2E,4E,6R)-7-[4-(dimethylamino)phenyl]-4,6-dimethyl-7-oxohepta-2,4-dienoyl]amino]-3-hydroxypropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78441919 | ChemSpider |