EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H59N11O11S2 |
| Net Charge | 0 |
| Average Mass | 934.112 |
| Monoisotopic Mass | 933.38369 |
| SMILES | CC=C(NC(=O)N[C@@H](Cc1ccccc1)C(=O)O)C(=O)N[C@@H](CO)C(=O)NC(=CC)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N1CCC[C@H]1[C@H]1NC(C(=O)N[C@@H](CCSC)C(=O)O)CS1 |
| InChI | InChI=1S/C40H59N11O11S2/c1-4-23(44-33(55)28(20-52)47-32(54)24(5-2)49-40(62)50-27(38(60)61)19-22-11-7-6-8-12-22)31(53)45-25(13-9-16-43-39(41)42)36(57)51-17-10-14-30(51)35-48-29(21-64-35)34(56)46-26(37(58)59)15-18-63-3/h4-8,11-12,25-30,35,48,52H,9-10,13-21H2,1-3H3,(H,44,55)(H,45,53)(H,46,56)(H,47,54)(H,58,59)(H,60,61)(H4,41,42,43)(H2,49,50,62)/t25-,26-,27-,28-,29?,30-,35-/m0/s1 |
| InChIKey | GWUHJAFRKSUHOU-CUIYLFHFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chitinimonas koreensis DSM 17726 (ncbitaxon:1121278) | - | PubMed (34301933) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chitinimide E (CHEBI:223131) is a polypeptide (CHEBI:15841) |