EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16O4 |
| Net Charge | 0 |
| Average Mass | 236.267 |
| Monoisotopic Mass | 236.10486 |
| SMILES | CC(C)=CCc1c(O)cc(C)c(C(=O)O)c1O |
| InChI | InChI=1S/C13H16O4/c1-7(2)4-5-9-10(14)6-8(3)11(12(9)15)13(16)17/h4,6,14-15H,5H2,1-3H3,(H,16,17) |
| InChIKey | FZLIGQLGBRLYQX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Colletotrichum higginsianum (ncbitaxon:80884) | - | PubMed (30776231) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Colletorin D acid (CHEBI:223127) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 2,4-dihydroxy-6-methyl-3-(3-methylbut-2-enyl)benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 127432033 | ChemSpider |